2-Fluoro-6-nitrobenzene-1-sulfonyl chloride, 95+%
cas: 887266-98-0 — see every product listed under this CAS number, including other names
2-Fluoro-6-nitrobenzene-1-sulfonyl chloride, 95+% (CAS 887266-98-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F665642-100MG |
| cas | 887266-98-0 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1060.06 Pln | |
| Fluorochem | 250mg | 1710.87 Pln | |
| Fluorochem | 1g | 4454.70 Pln | |
| Ambeed | 250mg | 598.44 Pln | |
| Ambeed | 1g | 1471.75 Pln | |
| Ambeed | 5g | 4514.44 Pln | |
| Chemat | 100mg | 726.80 Pln | |
| Chemat | 250mg | 1192.40 Pln | |
| Chemat | 1g | 3112.40 Pln | |
| BLDpharm | 100mg | 542.06 Pln | |
| BLDpharm | 250mg | 642.02 Pln | |
| BLDpharm | 1g | 1580.58 Pln | |
| BLDpharm | 5g | 4862.76 Pln |
properties
| purity | 95+% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-fluoro-6-nitrobenzenesulfonyl chloride (CAS 887266-98-0) is a chemical compound with the molecular formula C6H3ClFNO4S and a molecular weight of 239.61 g/mol. IUPAC name: 2-fluoro-6-nitrobenzenesulfonyl chloride. InChIKey: QTNQIGYAUISKNU-UHFFFAOYSA-N.
| Molecular formula | C6H3ClFNO4S |
|---|---|
| Molecular weight | 239.61 g/mol |
| IUPAC name | 2-fluoro-6-nitrobenzenesulfonyl chloride |
| InChIKey | QTNQIGYAUISKNU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)