cas: 58089-25-1 — see every product listed under this CAS number, including other names
2-Mercapto-1H-benzimidazole-5-carboxylic acid, 97%, 97% (CAS 58089-25-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148HM-100mg |
| cas | 58089-25-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 280.40 Pln | |
| Chemat | 10g | 405.20 Pln | |
| Chemat | 25g | 808.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid (CAS 58089-25-1) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid. InChIKey: DCRZVUIGGYMOBI-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid |
| InChIKey | DCRZVUIGGYMOBI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=S)N2 |
Computed by PubChem (NCBI)