cas: 58089-25-1 — see every product listed under this CAS number, including other names
2-Mercapto-5-benzimidazolecarboxylic Acid 97% (CAS 58089-25-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A392335-250mg |
| cas | 58089-25-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 337.00 Pln | |
| Ambeed | 25g | 1082.38 Pln | |
| Ambeed | 100g | 4108.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A392335 |
2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid (CAS 58089-25-1) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid. InChIKey: DCRZVUIGGYMOBI-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | 2-sulfanylidene-1,3-dihydrobenzimidazole-5-carboxylic acid |
| InChIKey | DCRZVUIGGYMOBI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=S)N2 |
Computed by PubChem (NCBI)