cas: 342618-24-0 — see every product listed under this CAS number, including other names
2-Methyl-5-nitroisonicotinic acid, 97%, 97% (CAS 342618-24-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I7RN-100mg |
| cas | 342618-24-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 500mg | 755.60 Pln | |
| Chemat | 1g | 1106.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-methyl-5-nitropyridine-4-carboxylic acid (CAS 342618-24-0) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 2-methyl-5-nitropyridine-4-carboxylic acid. InChIKey: NUSSTXJBEAIFEV-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 2-methyl-5-nitropyridine-4-carboxylic acid |
| InChIKey | NUSSTXJBEAIFEV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=N1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)