Products 1523570-93-5
CAS 1523570-93-5 appears in our catalog under these names: 6-Methyl-5-nitronicotinic acid, 95%, 6-Methyl-5-nitronicotinic acid, 97%, 6-METHYL-5-NITRONICOTINIC ACID, 98%, 6-Methyl-5-nitronicotinic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 250mg, 100mg.
6-methyl-5-nitropyridine-3-carboxylic acid (CAS 1523570-93-5) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 6-methyl-5-nitropyridine-3-carboxylic acid. InChIKey: GEVUGWURIMZLKE-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 6-methyl-5-nitropyridine-3-carboxylic acid |
| InChIKey | GEVUGWURIMZLKE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)