2-Oxa-6-azaspiro[3.4]octane hemioxalate, 98%
cas: 1523570-96-8 — see every product listed under this CAS number, including other names
2-Oxa-6-azaspiro[3.4]octane hemioxalate, 98% (CAS 1523570-96-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A542261-250mg |
| cas | 1523570-96-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 960.00 Pln | |
| Ambeed | 5g | 3880.31 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 414.32 Pln | |
| BLDpharm | 1g | 1030.77 Pln | |
| BLDpharm | 5g | 4179.66 Pln | |
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 367.60 Pln | |
| Fluorochem | 500mg | 549.82 Pln | |
| Fluorochem | 1g | 987.17 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Bis(2-oxa-7-azaspiro[3.4]octane);oxalic acid (CAS 1523570-96-8) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: bis(2-oxa-7-azaspiro[3.4]octane);oxalic acid. InChIKey: DREVFFJHSWBTQS-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O6 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | bis(2-oxa-7-azaspiro[3.4]octane);oxalic acid |
| InChIKey | DREVFFJHSWBTQS-UHFFFAOYSA-N |
| SMILES | C1CNCC12COC2.C1CNCC12COC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)