Products 1955514-54-1

CAS 1955514-54-1 appears in our catalog under these names: 1,7-Diaza-spiro[3.5]nonane-1-carboxylic acidtert-butyl ester oxalate, 95%, 1,7-Diaza-spiro(3.5)nonane-1-carboxylicacidtert-butylester oxalate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 1,7-diazaspiro[3.5]nonane-1-carboxylate;oxalic acid (CAS 1955514-54-1) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: tert-butyl 1,7-diazaspiro[3.5]nonane-1-carboxylate;oxalic acid. InChIKey: XOAJRPVKWLHFKX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H24N2O6
Molecular weight316.35 g/mol
IUPAC nametert-butyl 1,7-diazaspiro[3.5]nonane-1-carboxylate;oxalic acid
InChIKeyXOAJRPVKWLHFKX-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC12CCNCC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)