Products 1408076-07-2

CAS 1408076-07-2 appears in our catalog under these names: 5-Boc-2,5-diazaspiro[3.5]nonane oxalate, 95%, 5-Boc-2,5-diazaspiro[3.5]nonane hemioxalate, 95%, 5–Boc–2,5–diazaspiro(3·5)nonane oxalate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2,5-diazaspiro[3.5]nonane-5-carboxylate;oxalic acid (CAS 1408076-07-2) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: tert-butyl 2,5-diazaspiro[3.5]nonane-5-carboxylate;oxalic acid. InChIKey: GTZFDVHPOHCJJZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H24N2O6
Molecular weight316.35 g/mol
IUPAC nametert-butyl 2,5-diazaspiro[3.5]nonane-5-carboxylate;oxalic acid
InChIKeyGTZFDVHPOHCJJZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCCC12CNC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)