Products 1380571-82-3
CAS 1380571-82-3 appears in our catalog under these names: 2–Oxa–5–azaspiro(3·4)octane hemioxalate, 2-Oxa-5-azaspiro[3.4]octane hemioxalate, 95%, 2-Oxa-5-azaspiro(3.4)octane hemioxalate, 2-Oxa-5-azaspiro[3.4]octane oxalate(2:1) 97%, 2-Oxa-5-azaspiro[3.4]octane oxalate, 97%, 97%. Offered by: GLPBio, Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 50mg.
Bis(2-oxa-5-azaspiro[3.4]octane);oxalic acid (CAS 1380571-82-3) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: bis(2-oxa-5-azaspiro[3.4]octane);oxalic acid. InChIKey: GKPRXKGNXUGYIQ-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O6 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | bis(2-oxa-5-azaspiro[3.4]octane);oxalic acid |
| InChIKey | GKPRXKGNXUGYIQ-UHFFFAOYSA-N |
| SMILES | C1CC2(COC2)NC1.C1CC2(COC2)NC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)