CAS 2173991-65-4 appears in our catalog under these names: Oxalic acid tert-butyl n-(2-azaspiro[3.3]heptan-6-yl)-n-methylcarbamate, 95%, tert-Butyl methyl(2-azaspiro(3.3)heptan-6-yl)carbamate oxalate, 97%, tert-Butyl methyl(2-azaspiro[3.3]heptan-6-yl)carbamate oxalate, 97%, 97%, tert-butyl N-(2-azaspiro[3.3]heptan-6-yl)-N-methyl-carbamate,oxalic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg, 500mg.
Tert-butyl N-(2-azaspiro[3.3]heptan-6-yl)-N-methylcarbamate;oxalic acid (CAS 2173991-65-4) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: tert-butyl N-(2-azaspiro[3.3]heptan-6-yl)-N-methylcarbamate;oxalic acid. InChIKey: RSHZILLHUIRCLU-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O6 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | tert-butyl N-(2-azaspiro[3.3]heptan-6-yl)-N-methylcarbamate;oxalic acid |
| InChIKey | RSHZILLHUIRCLU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1CC2(C1)CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)