CAS 2177258-19-2 appears in our catalog under these names: Cis-hexahydro-2h-furo[3,2-b]pyrrole oxalate, 95%, cis-Hexahydro-2H-furo(3,2-b)pyrrole hemioxalate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Bis((3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole);oxalic acid (CAS 2177258-19-2) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: bis((3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole);oxalic acid. InChIKey: UYFMUKXGRKDHGY-LDCPCGJSSA-N.
| Molecular formula | C14H24N2O6 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | bis((3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrole);oxalic acid |
| InChIKey | UYFMUKXGRKDHGY-LDCPCGJSSA-N |
| SMILES | C1CN[C@H]2[C@@H]1OCC2.C1CN[C@H]2[C@@H]1OCC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)