CAS 1523571-99-4 appears in our catalog under these names: 6-Oxa-1-azaspiro[3.4]octane hemioxalate, 95%, 6-Oxa-1-azaspiro(3.4)octane hemioxalate, 97%, 6-oxa-1-azaspiro(3.4)octane hemioxalate, 6-Oxa-1-azaspiro[3.4]octane hemioxalate 95%, 6-Oxa-1-azaspiro[3.4]octane oxalate(2:1), 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 25g, 250mg, 1g, 5g, 50mg, 100mg, 500mg.
Bis(7-oxa-1-azaspiro[3.4]octane);oxalic acid (CAS 1523571-99-4) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: bis(7-oxa-1-azaspiro[3.4]octane);oxalic acid. InChIKey: UYHNJOQRRFVIHM-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O6 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | bis(7-oxa-1-azaspiro[3.4]octane);oxalic acid |
| InChIKey | UYHNJOQRRFVIHM-UHFFFAOYSA-N |
| SMILES | C1CNC12CCOC2.C1CNC12CCOC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)