Products 1227381-86-3

CAS 1227381-86-3 appears in our catalog under these names: 6–Boc–2,6–diazaspiro(3·5)nonane oxalate, 6-Boc-2,6-diazaspiro[3.5]nonane oxalate, 95%, tert-Butyl 2,6-diazaspiro[3.5]nonane-6-carboxylate hemioxalate, 95%, tert-Butyl 2,6-diazaspiro(3.5)nonane-6-carboxylate oxalate, 98+%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2,6-diazaspiro[3.5]nonane-6-carboxylate;oxalic acid (CAS 1227381-86-3) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: tert-butyl 2,6-diazaspiro[3.5]nonane-6-carboxylate;oxalic acid. InChIKey: DBZCNUZBMSKAMT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H24N2O6
Molecular weight316.35 g/mol
IUPAC nametert-butyl 2,6-diazaspiro[3.5]nonane-6-carboxylate;oxalic acid
InChIKeyDBZCNUZBMSKAMT-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC2(C1)CNC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)