Products 1180112-42-8

CAS 1180112-42-8 appears in our catalog under these names: 7-Boc-1,7-diaza-spiro[3.5]nonane hemioxalate, 95%, tert-Butyl 1,7-diazaspiro(3.5)nonane-7-carboxylate oxalate, 98+%, 7–Boc–1,7–diaza–spiro(3·5)nonane oxalate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate;oxalic acid (CAS 1180112-42-8) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: tert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate;oxalic acid. InChIKey: HLBLCLWSYNFUSK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H24N2O6
Molecular weight316.35 g/mol
IUPAC nametert-butyl 1,7-diazaspiro[3.5]nonane-7-carboxylate;oxalic acid
InChIKeyHLBLCLWSYNFUSK-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CCN2)CC1.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)