Products 2203514-89-8

CAS 2203514-89-8 is the registry number for tert-Butyl 1-amino-6-azaspiro[3.4]octane-6-carboxylate oxalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 3-amino-6-azaspiro[3.4]octane-6-carboxylate;oxalic acid (CAS 2203514-89-8) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: tert-butyl 3-amino-6-azaspiro[3.4]octane-6-carboxylate;oxalic acid. InChIKey: IIONVFZZNCZRLB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H24N2O6
Molecular weight316.35 g/mol
IUPAC nametert-butyl 3-amino-6-azaspiro[3.4]octane-6-carboxylate;oxalic acid
InChIKeyIIONVFZZNCZRLB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(C1)CCC2N.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)