CAS 2203514-89-8 is the registry number for tert-Butyl 1-amino-6-azaspiro[3.4]octane-6-carboxylate oxalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-amino-6-azaspiro[3.4]octane-6-carboxylate;oxalic acid (CAS 2203514-89-8) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: tert-butyl 3-amino-6-azaspiro[3.4]octane-6-carboxylate;oxalic acid. InChIKey: IIONVFZZNCZRLB-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O6 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | tert-butyl 3-amino-6-azaspiro[3.4]octane-6-carboxylate;oxalic acid |
| InChIKey | IIONVFZZNCZRLB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CCC2N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)