2-methoxy-3-(methoxycarbonyl)phenylboronic acid, 97%, 97%
cas: 1332637-14-5 — see every product listed under this CAS number, including other names
2-methoxy-3-(methoxycarbonyl)phenylboronic acid, 97%, 97% (CAS 1332637-14-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HSUK-100mg |
| cas | 1332637-14-5 |
| size | 100mg |
| availability | 150g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 645.20 Pln | |
| Chemat | 5g | 2402.00 Pln | |
| Chemat | 25g | 8834.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2-methoxy-3-methoxycarbonylphenyl)boronic acid (CAS 1332637-14-5) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: (2-methoxy-3-methoxycarbonylphenyl)boronic acid. InChIKey: YUUSYICBNQHHNZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | (2-methoxy-3-methoxycarbonylphenyl)boronic acid |
| InChIKey | YUUSYICBNQHHNZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)C(=O)OC)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-methoxy-3-(methoxycarbonyl)phenylboronic acid, (2-Methoxy-3-(methoxycarbonyl)phenyl)boronic acid, (2-methoxy-3-methoxycarbonylphenyl)boronic acid, [2-methoxy-3-(methoxycarbonyl)phenyl]boronic acid, (2-Methoxy-3-(methoxycarbonyl)phenyl)boronicacid, (2-methoxy-3-methoxycarbonyl-phenyl)boronic acid, Benzoic acid, 3-borono-2-methoxy-, 1-methyl ester