cas: 1472624-85-3 — see every product listed under this CAS number, including other names
2H-1-Benzopyran-3-carboxylic acid, 7-[methyl(phenylmethyl)amino]-2-oxo-, 99% (CAS 1472624-85-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F861846-1MG |
| cas | 1472624-85-3 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1mg | 388.42 Pln | |
| Fluorochem | 5mg | 633.13 Pln |
| purity | 99% |
|---|---|
| delivery time | 3-4 weeks |
7-[benzyl(methyl)amino]-2-oxochromene-3-carboxylic acid (CAS 1472624-85-3) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: 7-[benzyl(methyl)amino]-2-oxochromene-3-carboxylic acid. InChIKey: XTKDQPFUOFAMRL-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | 7-[benzyl(methyl)amino]-2-oxochromene-3-carboxylic acid |
| InChIKey | XTKDQPFUOFAMRL-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)C2=CC3=C(C=C2)C=C(C(=O)O3)C(=O)O |
Computed by PubChem (NCBI)