cas: 1472624-85-3 — see every product listed under this CAS number, including other names
7-(Benzyl(methyl)amino)-2-oxo-2H-chromene-3-carboxylic acid, 99%, 99% (CAS 1472624-85-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112EQN-1mg |
| cas | 1472624-85-3 |
| size | 1mg |
| availability | 0.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 251.60 Pln | |
| Chemat | 5mg | 390.80 Pln | |
| Chemat | 25mg | 1053.20 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
7-[benzyl(methyl)amino]-2-oxochromene-3-carboxylic acid (CAS 1472624-85-3) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: 7-[benzyl(methyl)amino]-2-oxochromene-3-carboxylic acid. InChIKey: XTKDQPFUOFAMRL-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | 7-[benzyl(methyl)amino]-2-oxochromene-3-carboxylic acid |
| InChIKey | XTKDQPFUOFAMRL-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)C2=CC3=C(C=C2)C=C(C(=O)O3)C(=O)O |
Computed by PubChem (NCBI)