cas: 1472624-85-3 — see every product listed under this CAS number, including other names
7ACC2, 99.95% (CAS 1472624-85-3) is a chemical reagent available from Chemat. Available pack sizes: 5 mg, 25 mg, 50 mg, 2 mg, 10mM/1mL, 100 mg, 10 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-D0713-5 mg |
| cas | 1472624-85-3 |
| size | 5 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 mg | 551.89 Pln | |
| MedChemExpress | 25 mg | 1606.08 Pln | |
| MedChemExpress | 50 mg | 2576.68 Pln | |
| MedChemExpress | 2 mg | 407.93 Pln | |
| MedChemExpress | 10mM/1mL | 607.62 Pln | |
| MedChemExpress | 100 mg | 4053.47 Pln | |
| MedChemExpress | 10 mg | 839.82 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.95% |
7-[benzyl(methyl)amino]-2-oxochromene-3-carboxylic acid (CAS 1472624-85-3) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: 7-[benzyl(methyl)amino]-2-oxochromene-3-carboxylic acid. InChIKey: XTKDQPFUOFAMRL-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | 7-[benzyl(methyl)amino]-2-oxochromene-3-carboxylic acid |
| InChIKey | XTKDQPFUOFAMRL-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)C2=CC3=C(C=C2)C=C(C(=O)O3)C(=O)O |
Computed by PubChem (NCBI)