CAS 1472624-85-3 appears in our catalog under these names: 7Acc2, 95%, 7ACC2, 7ACC2/ 100%, 7ACC2 99%, 7-(Benzyl(methyl)amino)-2-oxo-2H-chromene-3-carboxylic acid, 99%, 99%. Offered by: Combi-blocks, GLPBio, TargetMol, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 10mg, 100mg, 5mg, 50mg, 1mg, 2mg.
7-[benzyl(methyl)amino]-2-oxochromene-3-carboxylic acid (CAS 1472624-85-3) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: 7-[benzyl(methyl)amino]-2-oxochromene-3-carboxylic acid. InChIKey: XTKDQPFUOFAMRL-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | 7-[benzyl(methyl)amino]-2-oxochromene-3-carboxylic acid |
| InChIKey | XTKDQPFUOFAMRL-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)C2=CC3=C(C=C2)C=C(C(=O)O3)C(=O)O |
Computed by PubChem (NCBI)