cas: 14760-30-6 — see every product listed under this CAS number, including other names
3'-Chloroacetophenone semicarbazone (CAS 14760-30-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXKS-50mg |
| cas | 14760-30-6 |
| size | 50mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 117.20 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 515.60 Pln |
| delivery time | 3 weeks |
|---|
[(E)-1-(3-chlorophenyl)ethylideneamino]urea (CAS 14760-30-6) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: [(E)-1-(3-chlorophenyl)ethylideneamino]urea. InChIKey: FMBJODQYWAEYGJ-WUXMJOGZSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | [(E)-1-(3-chlorophenyl)ethylideneamino]urea |
| InChIKey | FMBJODQYWAEYGJ-WUXMJOGZSA-N |
| SMILES | C/C(=N\NC(=O)N)/C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)