CAS 49837-94-7 appears in our catalog under these names: 4-(Aminomethyl)phthalazin-1(2h)-one hydrochloride, 95%, 4-(Aminomethyl)-1,2-dihydrophthalazin-1-one hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 250mg, 1g, 2,5g.
4-(aminomethyl)-2H-phthalazin-1-one;hydrochloride (CAS 49837-94-7) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: 4-(aminomethyl)-2H-phthalazin-1-one;hydrochloride. InChIKey: YXMHMCSNUDFQCQ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 4-(aminomethyl)-2H-phthalazin-1-one;hydrochloride |
| InChIKey | YXMHMCSNUDFQCQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NNC2=O)CN.Cl |
Computed by PubChem (NCBI)