Products 2260936-54-5
CAS 2260936-54-5 is the registry number for 4-(3-Methyl-1,2,4-oxadiazol-5-yl)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-(3-methyl-1,2,4-oxadiazol-5-yl)aniline;hydrochloride (CAS 2260936-54-5) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: 4-(3-methyl-1,2,4-oxadiazol-5-yl)aniline;hydrochloride. InChIKey: QTLJIADKYUGZQV-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)aniline;hydrochloride |
| InChIKey | QTLJIADKYUGZQV-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)