cas: 237761-76-1 — see every product listed under this CAS number, including other names
3,4-Difluoro-5-(trifluoromethyl)benzoic acid, 95+% (CAS 237761-76-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A453783-1g |
| cas | 237761-76-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 7602.07 Pln | |
| AmBeed | 5g | 26474.56 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,4-difluoro-5-(trifluoromethyl)benzoic acid (CAS 237761-76-1) is a chemical compound with the molecular formula C8H3F5O2 and a molecular weight of 226.10 g/mol. IUPAC name: 3,4-difluoro-5-(trifluoromethyl)benzoic acid. InChIKey: CKUNRJPLPRCMCL-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O2 |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 3,4-difluoro-5-(trifluoromethyl)benzoic acid |
| InChIKey | CKUNRJPLPRCMCL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)F)F)C(=O)O |
Computed by PubChem (NCBI)