cas: 1162261-96-2 — see every product listed under this CAS number, including other names
3,4-Difluoro-5-ethoxyphenylboronic acid (CAS 1162261-96-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627414-1G |
| cas | 1162261-96-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2845.89 Pln | |
| Fluorochem | 5g | 8406.43 Pln |
| delivery time | 3-4 weeks |
|---|
(3-ethoxy-4,5-difluorophenyl)boronic acid (CAS 1162261-96-2) is a chemical compound with the molecular formula C8H9BF2O3 and a molecular weight of 201.97 g/mol. IUPAC name: (3-ethoxy-4,5-difluorophenyl)boronic acid. InChIKey: ADPWEMTWYVQLFI-UHFFFAOYSA-N.
| Molecular formula | C8H9BF2O3 |
|---|---|
| Molecular weight | 201.97 g/mol |
| IUPAC name | (3-ethoxy-4,5-difluorophenyl)boronic acid |
| InChIKey | ADPWEMTWYVQLFI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)OCC)(O)O |
Computed by PubChem (NCBI)