cas: 21386-43-6 — see every product listed under this CAS number, including other names
3,5-Dibromo-2-hydroxybenzaldehyde oxime, ≥98%(GC), ≥98%(GC) (CAS 21386-43-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IL8-1g |
| cas | 21386-43-6 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 232.40 Pln |
| purity | ≥98%(GC) |
|---|---|
| delivery time | 3 weeks |
2,4-dibromo-6-(hydroxyiminomethyl)phenol (CAS 21386-43-6) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 2,4-dibromo-6-(hydroxyiminomethyl)phenol. InChIKey: LRNICNSWROUZCF-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 2,4-dibromo-6-(hydroxyiminomethyl)phenol |
| InChIKey | LRNICNSWROUZCF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=NO)O)Br)Br |
Computed by PubChem (NCBI)