cas: 21386-43-6 — see every product listed under this CAS number, including other names
3,5-Dibromosalicylaldoxime, >98.0%(GC) (CAS 21386-43-6) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D0210-5G |
| cas | 21386-43-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 192.10 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2,4-dibromo-6-(hydroxyiminomethyl)phenol (CAS 21386-43-6) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 2,4-dibromo-6-(hydroxyiminomethyl)phenol. InChIKey: LRNICNSWROUZCF-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 2,4-dibromo-6-(hydroxyiminomethyl)phenol |
| InChIKey | LRNICNSWROUZCF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=NO)O)Br)Br |
Computed by PubChem (NCBI)