3,5-Dibromoisonicotinic acid, 98%, 98%
cas: 13958-91-3 — see every product listed under this CAS number, including other names
3,5-Dibromoisonicotinic acid, 98%, 98% (CAS 13958-91-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112BAZ-1g |
| cas | 13958-91-3 |
| size | 1g |
| availability | 300g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 25g | 448.40 Pln | |
| Chemat | 100g | 1278.80 Pln | |
| Chemat | 10g | 227.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,5-dibromopyridine-4-carboxylic acid (CAS 13958-91-3) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 3,5-dibromopyridine-4-carboxylic acid. InChIKey: LRKLXFGPVUZEDK-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 3,5-dibromopyridine-4-carboxylic acid |
| InChIKey | LRKLXFGPVUZEDK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Br)C(=O)O)Br |
Computed by PubChem (NCBI)