cas: 1133116-49-0 — see every product listed under this CAS number, including other names
3,6-Dibromopicolinic acid, 97%, 97% (CAS 1133116-49-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1180F1-100mg |
| cas | 1133116-49-0 |
| size | 100mg |
| availability | 31g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 530.00 Pln | |
| Chemat | 10g | 813.20 Pln | |
| Chemat | 25g | 1706.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,6-dibromopyridine-2-carboxylic acid (CAS 1133116-49-0) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 3,6-dibromopyridine-2-carboxylic acid. InChIKey: YHHZRFKRFAFHRJ-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 3,6-dibromopyridine-2-carboxylic acid |
| InChIKey | YHHZRFKRFAFHRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Br)C(=O)O)Br |
Computed by PubChem (NCBI)