cas: 3919-76-4 — see every product listed under this CAS number, including other names
3-(2,6-Dichlorophenyl)-5-methylisoxazole-4-carboxylic acid, 97% (CAS 3919-76-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 100g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | SB00572EA |
| cas | 3919-76-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 10g | 444.94 Pln | |
| Thermo Scientific | 50g | 773.80 Pln | |
| Thermo Scientific | 100g | 1201.43 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 3919-76-4) is a chemical compound with the molecular formula C11H7Cl2NO3 and a molecular weight of 272.08 g/mol. IUPAC name: 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: WQXUUMUOERZZAE-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO3 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | WQXUUMUOERZZAE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)