cas: 3919-76-4 — see every product listed under this CAS number, including other names
5-Methyl-3-(2',6'-dichlorophenyl)-4-isoxazolecarboxylic acid, 98% (CAS 3919-76-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212570-5G |
| cas | 3919-76-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 487.35 Pln | |
| Fluorochem | 10g | 799.74 Pln | |
| Fluorochem | 25g | 1736.91 Pln | |
| Fluorochem | 100g | 3173.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 3919-76-4) is a chemical compound with the molecular formula C11H7Cl2NO3 and a molecular weight of 272.08 g/mol. IUPAC name: 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: WQXUUMUOERZZAE-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO3 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | WQXUUMUOERZZAE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)