cas: 23598-72-3 — see every product listed under this CAS number, including other names
3-(2-Chlorophenyl)-5-methyl-4-isoxazolecarboxylic acid, 97%, 97% (CAS 23598-72-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113NU0-5g |
| cas | 23598-72-3 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 150.80 Pln | |
| Chemat | 10g | 213.20 Pln | |
| Chemat | 25g | 366.80 Pln | |
| Chemat | 100g | 1038.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 23598-72-3) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: UVEPOHNXGXVOJE-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | UVEPOHNXGXVOJE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)