cas: 23598-72-3 — see every product listed under this CAS number, including other names
3-(2-Chlorophenyl)-5-methylisoxazole-4-carboxylic acid (CAS 23598-72-3) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250g, 1g, 10g, 50g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | FC43721-500g |
| cas | 23598-72-3 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 500g | price on request | |
| Biosynth | 250g | price on request | |
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 10g | 414.46 Pln | |
| Fluorochem | 50g | 1351.63 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Sourcing |
| purity | No data |
| delivery time | 3-4 weeks |
3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 23598-72-3) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: UVEPOHNXGXVOJE-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | UVEPOHNXGXVOJE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)