cas: 19922-07-7 — see every product listed under this CAS number, including other names
3-(4-Chlorophenyl)-1,2,4-thiadiazol-5-amine, 98%, 98% (CAS 19922-07-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113BZ8-100mg |
| cas | 19922-07-7 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 678.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(4-chlorophenyl)-1,2,4-thiadiazol-5-amine (CAS 19922-07-7) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,2,4-thiadiazol-5-amine. InChIKey: IUSHKZWNRIGLGO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,2,4-thiadiazol-5-amine |
| InChIKey | IUSHKZWNRIGLGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NSC(=N2)N)Cl |
Computed by PubChem (NCBI)