cas: 238428-26-7 — see every product listed under this CAS number, including other names
3-(Methylsulfonylamino)benzylamine Hydrochloride 98% (CAS 238428-26-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A333291-100mg |
| cas | 238428-26-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 676.31 Pln | |
| Ambeed | 5g | 1900.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A333291 |
N-[3-(aminomethyl)phenyl]methanesulfonamide;hydrochloride (CAS 238428-26-7) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: N-[3-(aminomethyl)phenyl]methanesulfonamide;hydrochloride. InChIKey: QRQYQHPUXNPLOG-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | N-[3-(aminomethyl)phenyl]methanesulfonamide;hydrochloride |
| InChIKey | QRQYQHPUXNPLOG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=CC(=C1)CN.Cl |
Computed by PubChem (NCBI)