cas: 6968-22-5 — see every product listed under this CAS number, including other names
3-Amino-4-nitrobenzoic acid, 96%, 96% (CAS 6968-22-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 100g, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116J7B-100mg |
| cas | 6968-22-5 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 100g | 5824.40 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 1005.20 Pln | |
| Chemat | 25g | 1864.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-amino-4-nitrobenzoic acid (CAS 6968-22-5) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 3-amino-4-nitrobenzoic acid. InChIKey: LYCCVBLUKJRDOF-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 3-amino-4-nitrobenzoic acid |
| InChIKey | LYCCVBLUKJRDOF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)