cas: 618-84-8 — see every product listed under this CAS number, including other names
3-Amino-5-nitrobenzoic acid, 95%, 95% (CAS 618-84-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E9XK-250mg |
| cas | 618-84-8 |
| size | 250mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 275.60 Pln | |
| Chemat | 25g | 520.40 Pln | |
| Chemat | 50g | 890.00 Pln | |
| Chemat | 500g | 6792.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-amino-5-nitrobenzoic acid (CAS 618-84-8) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 3-amino-5-nitrobenzoic acid. InChIKey: ZNVHAQRPXAQKRU-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 3-amino-5-nitrobenzoic acid |
| InChIKey | ZNVHAQRPXAQKRU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)