CAS 870718-07-3 appears in our catalog under these names: 3–Benzyloxy–2,6–difluorophenylboronic acid, 3-(Benzyloxy)-2,6-difluorophenylboronic acid, 98%, 3-Benzyloxy-2,6-difluorophenylboronic acid, 95%, 3-(Benzyloxy)-2,6-difluorophenylboronic acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 250mg, 10g.
(2,6-difluoro-3-phenylmethoxyphenyl)boronic acid (CAS 870718-07-3) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (2,6-difluoro-3-phenylmethoxyphenyl)boronic acid. InChIKey: MUKMMBLTLNKOAC-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (2,6-difluoro-3-phenylmethoxyphenyl)boronic acid |
| InChIKey | MUKMMBLTLNKOAC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OCC2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)