cas: 20731-48-0 — see every product listed under this CAS number, including other names
3-Bromo-4,5-dimethoxybenzoic Acid, >98.0%(GC)(T) (CAS 20731-48-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B5252-1G |
| cas | 20731-48-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 728.08 Pln | |
| TCI | 5g | 2380.28 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
3-bromo-4,5-dimethoxybenzoic acid (CAS 20731-48-0) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 3-bromo-4,5-dimethoxybenzoic acid. InChIKey: ZODURELBYVOPGP-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 3-bromo-4,5-dimethoxybenzoic acid |
| InChIKey | ZODURELBYVOPGP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)O)Br)OC |
Computed by PubChem (NCBI)