cas: 20731-48-0 — see every product listed under this CAS number, including other names
3-Bromo-4,5-dimethoxybenzoic acid, 98% (CAS 20731-48-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A204278-5g |
| cas | 20731-48-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5994.10 Pln | |
| AmBeed | 250mg | 1235.29 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-4,5-dimethoxybenzoic acid (CAS 20731-48-0) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 3-bromo-4,5-dimethoxybenzoic acid. InChIKey: ZODURELBYVOPGP-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 3-bromo-4,5-dimethoxybenzoic acid |
| InChIKey | ZODURELBYVOPGP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)O)Br)OC |
Computed by PubChem (NCBI)