3-Bromo-4-chloro-5-fluorobenzoic acid, 95%
cas: 1357942-87-0 — see every product listed under this CAS number, including other names
3-Bromo-4-chloro-5-fluorobenzoic acid, 95% (CAS 1357942-87-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A239492-250mg |
| cas | 1357942-87-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 570.62 Pln | |
| Ambeed | 5g | 1627.50 Pln | |
| Ambeed | 10g | 2795.62 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 458.00 Pln | |
| Chemat | 5g | 1629.20 Pln | |
| Chemat | 10g | 2805.20 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 614.25 Pln | |
| BLDpharm | 5g | 1747.19 Pln | |
| BLDpharm | 10g | 3007.85 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-bromo-4-chloro-5-fluorobenzoic acid (CAS 1357942-87-0) is a chemical compound with the molecular formula C7H3BrClFO2 and a molecular weight of 253.45 g/mol. IUPAC name: 3-bromo-4-chloro-5-fluorobenzoic acid. InChIKey: CLXLNVHYXWMAAZ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO2 |
|---|---|
| Molecular weight | 253.45 g/mol |
| IUPAC name | 3-bromo-4-chloro-5-fluorobenzoic acid |
| InChIKey | CLXLNVHYXWMAAZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)Br)C(=O)O |
Computed by PubChem (NCBI)