Products 1114809-13-0
CAS 1114809-13-0 appears in our catalog under these names: 3-Bromo-2-chloro-6-fluorobenzoic acid, 95%, 3-BROMO-2-CHLORO-6-FLUOROBENZOIC ACID, 3-Bromo-2-chloro-6-fluorobenzoic acid 97%, 3-Bromo-2-chloro-6-fluorobenzoic acid, 97%, 97%, 3-Bromo-2-chloro-6-fluorobenzoic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g.
3-bromo-2-chloro-6-fluorobenzoic acid (CAS 1114809-13-0) is a chemical compound with the molecular formula C7H3BrClFO2 and a molecular weight of 253.45 g/mol. IUPAC name: 3-bromo-2-chloro-6-fluorobenzoic acid. InChIKey: BPKBUPFQEALBFX-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO2 |
|---|---|
| Molecular weight | 253.45 g/mol |
| IUPAC name | 3-bromo-2-chloro-6-fluorobenzoic acid |
| InChIKey | BPKBUPFQEALBFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)O)Cl)Br |
Computed by PubChem (NCBI)