CAS 1695489-54-3 appears in our catalog under these names: 2-Bromo-6-chloro-4-fluorobenzoic acid, 95%, 2-bromo-6-chloro-4-fluorobenzoic acid, 2-Bromo-6-chloro-4-fluorobenzoic acid 97%, 2-Bromo-6-chloro-4-fluorobenzoic acid, ≥97.1%, ≥97.1%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 2,5g, 100mg.
2-bromo-6-chloro-4-fluorobenzoic acid (CAS 1695489-54-3) is a chemical compound with the molecular formula C7H3BrClFO2 and a molecular weight of 253.45 g/mol. IUPAC name: 2-bromo-6-chloro-4-fluorobenzoic acid. InChIKey: DQTOVIXCGACNJZ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO2 |
|---|---|
| Molecular weight | 253.45 g/mol |
| IUPAC name | 2-bromo-6-chloro-4-fluorobenzoic acid |
| InChIKey | DQTOVIXCGACNJZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(=O)O)Br)F |
Computed by PubChem (NCBI)