CAS 176548-68-8 appears in our catalog under these names: 3-Bromo-5-chloro-4-fluorobenzoic acid, 97, 3-Bromo-5-chloro-4-fluorobenzoic acid, 98%, 3-Bromo-5-chloro-4-fluorobenzoic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
3-bromo-5-chloro-4-fluorobenzoic acid (CAS 176548-68-8) is a chemical compound with the molecular formula C7H3BrClFO2 and a molecular weight of 253.45 g/mol. IUPAC name: 3-bromo-5-chloro-4-fluorobenzoic acid. InChIKey: PUCJNBCLZFKJAI-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO2 |
|---|---|
| Molecular weight | 253.45 g/mol |
| IUPAC name | 3-bromo-5-chloro-4-fluorobenzoic acid |
| InChIKey | PUCJNBCLZFKJAI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)F)Br)C(=O)O |
Computed by PubChem (NCBI)