Products 1428234-67-6
CAS 1428234-67-6 appears in our catalog under these names: 6–Bromo–3–chloro–2–fluorobenzoic acid, 6-Bromo-3-chloro-2-fluorobenzoic acid, 6-Bromo-3-chloro-2-fluorobenzoic acid, 95%, 6-Bromo-3-chloro-2-fluorobenzoic acid 98%, 6-Bromo-3-chloro-2-fluorobenzoic acid, 98%, 98%. Offered by: GLPBio, Biosynth, Combi-blocks, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,5g, 500mg, 10g.
6-bromo-3-chloro-2-fluorobenzoic acid (CAS 1428234-67-6) is a chemical compound with the molecular formula C7H3BrClFO2 and a molecular weight of 253.45 g/mol. IUPAC name: 6-bromo-3-chloro-2-fluorobenzoic acid. InChIKey: XJXNCYHFUPFGSY-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO2 |
|---|---|
| Molecular weight | 253.45 g/mol |
| IUPAC name | 6-bromo-3-chloro-2-fluorobenzoic acid |
| InChIKey | XJXNCYHFUPFGSY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)F)C(=O)O)Br |
Computed by PubChem (NCBI)