Products 702640-51-5
CAS 702640-51-5 appears in our catalog under these names: 3-Bromo-6-chloro-2-fluorobenzoic acid, 95%, 3-Bromo-6-chloro-2-fluorobenzoic acid, 97%, 3–Bromo–6–chloro–2–fluorobenzoic acid, 3-Bromo-6-chloro-2-fluorobenzoic acid 95%, 3-Bromo-6-chloro-2-fluorobenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 100g, 5g, 10g, 100mg, 250mg, 500mg.
3-bromo-6-chloro-2-fluorobenzoic acid (CAS 702640-51-5) is a chemical compound with the molecular formula C7H3BrClFO2 and a molecular weight of 253.45 g/mol. IUPAC name: 3-bromo-6-chloro-2-fluorobenzoic acid. InChIKey: RMFKXLDHDDWWGR-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO2 |
|---|---|
| Molecular weight | 253.45 g/mol |
| IUPAC name | 3-bromo-6-chloro-2-fluorobenzoic acid |
| InChIKey | RMFKXLDHDDWWGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)C(=O)O)F)Br |
Computed by PubChem (NCBI)