Products 1677706-23-8
CAS 1677706-23-8 appears in our catalog under these names: 3-Bromo-4-chloro-2-fluorobenzoic acid, 95%, 3-Bromo-4-chloro-2-fluorobenzoic acid, 3-Bromo-4-chloro-2-fluorobenzoic acid 95%, 3-Bromo-4-chloro-2-fluorobenzoic acid, 98%, 98%, 3-BROMO-4-CHLORO-2-FLUOROBENZOIC ACID, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 5g, 50mg, 100mg, 500mg, 10g.
3-bromo-4-chloro-2-fluorobenzoic acid (CAS 1677706-23-8) is a chemical compound with the molecular formula C7H3BrClFO2 and a molecular weight of 253.45 g/mol. IUPAC name: 3-bromo-4-chloro-2-fluorobenzoic acid. InChIKey: NPOISHYRKYHKDO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO2 |
|---|---|
| Molecular weight | 253.45 g/mol |
| IUPAC name | 3-bromo-4-chloro-2-fluorobenzoic acid |
| InChIKey | NPOISHYRKYHKDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)Br)Cl |
Computed by PubChem (NCBI)