CAS 1349708-91-3 appears in our catalog under these names: 4-Bromo-5-chloro-2-fluorobenzoic acid, 98%, 4-bromo-5-chloro-2-fluorobenzoic Acid, 4-Bromo-5-chloro-2-fluorobenzoic acid 98%, 4-Bromo-5-chloro-2-fluorobenzoic acid, 98%, 98%, 4-Bromo-5-chloro-2-fluorobenzoic acid, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg, 10g.
4-bromo-5-chloro-2-fluorobenzoic acid (CAS 1349708-91-3) is a chemical compound with the molecular formula C7H3BrClFO2 and a molecular weight of 253.45 g/mol. IUPAC name: 4-bromo-5-chloro-2-fluorobenzoic acid. InChIKey: FQYCZAHBPRQWRR-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO2 |
|---|---|
| Molecular weight | 253.45 g/mol |
| IUPAC name | 4-bromo-5-chloro-2-fluorobenzoic acid |
| InChIKey | FQYCZAHBPRQWRR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Br)F)C(=O)O |
Computed by PubChem (NCBI)