Products 1082040-61-6
CAS 1082040-61-6 appears in our catalog under these names: 2-Bromo-4-chloro-6-fluorobenzoic acid, 2-Bromo-4-chloro-6-fluorobenzoic acid, 96%, 2-Bromo-4-chloro-6-fluorobenzoic acid 95%, 2-Bromo-4-chloro-6-fluorobenzoic acid, 95%, 95%, 2-Bromo-4-chloro-6-fluorobenzoic acid, 97%. Offered by: Biosynth, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 250mg, 1g, 100mg, 10g.
2-bromo-4-chloro-6-fluorobenzoic acid (CAS 1082040-61-6) is a chemical compound with the molecular formula C7H3BrClFO2 and a molecular weight of 253.45 g/mol. IUPAC name: 2-bromo-4-chloro-6-fluorobenzoic acid. InChIKey: YGDCFZABHNKMTK-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO2 |
|---|---|
| Molecular weight | 253.45 g/mol |
| IUPAC name | 2-bromo-4-chloro-6-fluorobenzoic acid |
| InChIKey | YGDCFZABHNKMTK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)Br)Cl |
Computed by PubChem (NCBI)