CAS 1204219-98-6 appears in our catalog under these names: 5-Bromo-2-chloro-4-fluorobenzoic acid, 95%, 5-bromo-2-chloro-4-fluorobenzoic acid, 5-Bromo-2-chloro-4-fluorobenzoic acid, 97%, 97%, 5-Bromo-2-chloro-4-fluorobenzoic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 2,5g, 100mg, 10g, 25g, 100g.
5-bromo-2-chloro-4-fluorobenzoic acid (CAS 1204219-98-6) is a chemical compound with the molecular formula C7H3BrClFO2 and a molecular weight of 253.45 g/mol. IUPAC name: 5-bromo-2-chloro-4-fluorobenzoic acid. InChIKey: DTJGLOLRNBDUFB-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO2 |
|---|---|
| Molecular weight | 253.45 g/mol |
| IUPAC name | 5-bromo-2-chloro-4-fluorobenzoic acid |
| InChIKey | DTJGLOLRNBDUFB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)Cl)C(=O)O |
Computed by PubChem (NCBI)